C23H21ClF2N4O2 — CID 122602009
1-[(3R)-4-[6-chloro-8-fluoro-7-(2-fluoro-6-methoxyphenyl)quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 122602009) has the molecular formula C23H21ClF2N4O2 and a molecular weight of 458.90 g/mol. Its IUPAC name is 1-[(3R)-4-[6-chloro-8-fluoro-7-(2-fluoro-6-methoxyphenyl)quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-4-[6-chloro-8-fluoro-7-(2-fluoro-6-methoxyphenyl)quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122602009 |
| Molecular Formula | C23H21ClF2N4O2 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 1-[(3R)-4-[6-chloro-8-fluoro-7-(2-fluoro-6-methoxyphenyl)quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(F)c(-c4c(F)cccc4OC)c(Cl)cc23)[C@H](C)C1 |
| InChI | InChI=1S/C23H21ClF2N4O2/c1-4-18(31)29-8-9-30(13(2)11-29)23-14-10-15(24)19(21(26)22(14)27-12-28-23)20-16(25)6-5-7-17(20)32-3/h4-7,10,12-13H,1,8-9,11H2,2-3H3/t13-/m1/s1 |
| InChIKey | UUACOOBNUHBIDV-CYBMUJFWSA-N |
| XLogP | 4.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|