C22H20ClF2N4O6P — CID 122602064
[2-[6-chloro-8-fluoro-4-(4-prop-2-enoylpiperazin-1-yl)quinazolin-7-yl]-3-fluorophenoxy]methyl dihydrogen phosphate (PubChem CID 122602064) has the molecular formula C22H20ClF2N4O6P and a molecular weight of 540.85 g/mol. Its IUPAC name is [2-[6-chloro-8-fluoro-4-(4-prop-2-enoylpiperazin-1-yl)quinazolin-7-yl]-3-fluorophenoxy]methyl dihydrogen phosphate.
| Compound Name | [2-[6-chloro-8-fluoro-4-(4-prop-2-enoylpiperazin-1-yl)quinazolin-7-yl]-3-fluorophenoxy]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 122602064 |
| Molecular Formula | C22H20ClF2N4O6P |
| Molecular Weight | 540.85 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | [2-[6-chloro-8-fluoro-4-(4-prop-2-enoylpiperazin-1-yl)quinazolin-7-yl]-3-fluorophenoxy]methyl dihydrogen phosphate |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(F)c(-c4c(F)cccc4OCOP(=O)(O)O)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C22H20ClF2N4O6P/c1-2-17(30)28-6-8-29(9-7-28)22-13-10-14(23)18(20(25)21(13)26-11-27-22)19-15(24)4-3-5-16(19)34-12-35-36(31,32)33/h2-5,10-11H,1,6-9,12H2,(H2,31,32,33) |
| InChIKey | FULCWQZNRACTJM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.85 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|