C21H23BrClFN4O3 — CID 166463263
tert-butyl (4R,7R)-15-bromo-16-chloro-14-fluoro-4-methyl-8-oxo-9-(trideuteriomethyl)-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate (PubChem CID 166463263) has the molecular formula C21H23BrClFN4O3 and a molecular weight of 516.81 g/mol. Its IUPAC name is tert-butyl (4R,7R)-15-bromo-16-chloro-14-fluoro-4-methyl-8-oxo-9-(trideuteriomethyl)-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate.
| Compound Name | tert-butyl (4R,7R)-15-bromo-16-chloro-14-fluoro-4-methyl-8-oxo-9-(trideuteriomethyl)-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 166463263 |
| Molecular Formula | C21H23BrClFN4O3 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | tert-butyl (4R,7R)-15-bromo-16-chloro-14-fluoro-4-methyl-8-oxo-9-(trideuteriomethyl)-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
| SMILES | [2H]C([2H])([2H])N1C(=O)[C@H]2CN(C(=O)OC(C)(C)C)[C@H](C)CN2c2c1cnc1c(F)c(Br)c(Cl)cc21 |
| InChI | InChI=1S/C21H23BrClFN4O3/c1-10-8-28-14(9-27(10)20(30)31-21(2,3)4)19(29)26(5)13-7-25-17-11(18(13)28)6-12(23)15(22)16(17)24/h6-7,10,14H,8-9H2,1-5H3/t10-,14-/m1/s1/i5D3 |
| InChIKey | MWNVLRXZVXGDFT-XYLFFCCMSA-N |
| XLogP | 4.58 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|