C18H27N3O6 — CID 167220330
tert-butyl 3-(hydroxymethyl)-4-[2-(hydroxymethyl)-6-methyl-4-nitrophenyl]piperazine-1-carboxylate (PubChem CID 167220330) has the molecular formula C18H27N3O6 and a molecular weight of 381.43 g/mol. Its IUPAC name is tert-butyl 3-(hydroxymethyl)-4-[2-(hydroxymethyl)-6-methyl-4-nitrophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(hydroxymethyl)-4-[2-(hydroxymethyl)-6-methyl-4-nitrophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167220330 |
| Molecular Formula | C18H27N3O6 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | tert-butyl 3-(hydroxymethyl)-4-[2-(hydroxymethyl)-6-methyl-4-nitrophenyl]piperazine-1-carboxylate |
| SMILES | Cc1cc([N+](=O)[O-])cc(CO)c1N1CCN(C(=O)OC(C)(C)C)CC1CO |
| InChI | InChI=1S/C18H27N3O6/c1-12-7-14(21(25)26)8-13(10-22)16(12)20-6-5-19(9-15(20)11-23)17(24)27-18(2,3)4/h7-8,15,22-23H,5-6,9-11H2,1-4H3 |
| InChIKey | WOKSTJVZKFYABY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|