C16H22FN3O5 — CID 169207570
tert-butyl (3S)-4-(2-fluoro-4-nitrophenyl)-3-(hydroxymethyl)piperazine-1-carboxylate (PubChem CID 169207570) has the molecular formula C16H22FN3O5 and a molecular weight of 355.37 g/mol. Its IUPAC name is tert-butyl (3S)-4-(2-fluoro-4-nitrophenyl)-3-(hydroxymethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-(2-fluoro-4-nitrophenyl)-3-(hydroxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169207570 |
| Molecular Formula | C16H22FN3O5 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | tert-butyl (3S)-4-(2-fluoro-4-nitrophenyl)-3-(hydroxymethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2F)[C@H](CO)C1 |
| InChI | InChI=1S/C16H22FN3O5/c1-16(2,3)25-15(22)18-6-7-19(12(9-18)10-21)14-5-4-11(20(23)24)8-13(14)17/h4-5,8,12,21H,6-7,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | MKQNDAMLFQJDBZ-LBPRGKRZSA-N |
| XLogP | 2.15 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|