C16H20BrN3O5 — CID 155694995
tert-butyl (4aS)-7-bromo-9-nitro-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-3-carboxylate (PubChem CID 155694995) has the molecular formula C16H20BrN3O5 and a molecular weight of 414.26 g/mol. Its IUPAC name is tert-butyl (4aS)-7-bromo-9-nitro-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-3-carboxylate.
| Compound Name | tert-butyl (4aS)-7-bromo-9-nitro-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-3-carboxylate |
|---|---|
| PubChem CID | 155694995 |
| Molecular Formula | C16H20BrN3O5 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | tert-butyl (4aS)-7-bromo-9-nitro-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3cc([N+](=O)[O-])cc(Br)c3OC[C@@H]2C1 |
| InChI | InChI=1S/C16H20BrN3O5/c1-16(2,3)25-15(21)18-4-5-19-11(8-18)9-24-14-12(17)6-10(20(22)23)7-13(14)19/h6-7,11H,4-5,8-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | RRFDNQBTMTWQFZ-NSHDSACASA-N |
| XLogP | 3.18 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|