C17H20N4O5 — CID 171095007
tert-butyl (4aS)-9-cyano-8-nitro-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-3-carboxylate (PubChem CID 171095007) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is tert-butyl (4aS)-9-cyano-8-nitro-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-3-carboxylate.
| Compound Name | tert-butyl (4aS)-9-cyano-8-nitro-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-3-carboxylate |
|---|---|
| PubChem CID | 171095007 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | tert-butyl (4aS)-9-cyano-8-nitro-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3cc(C#N)c([N+](=O)[O-])cc3OC[C@@H]2C1 |
| InChI | InChI=1S/C17H20N4O5/c1-17(2,3)26-16(22)19-4-5-20-12(9-19)10-25-15-7-13(21(23)24)11(8-18)6-14(15)20/h6-7,12H,4-5,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | VEQBNCLGWBBFRY-LBPRGKRZSA-N |
| XLogP | 2.28 |
| TPSA | 108.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|