C18H23N5O2 — CID 171095267
(4aS)-8-amino-3-[(E)-4-(dimethylamino)but-2-enoyl]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-9-carbonitrile (PubChem CID 171095267) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is (4aS)-8-amino-3-[(E)-4-(dimethylamino)but-2-enoyl]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-9-carbonitrile.
| Compound Name | (4aS)-8-amino-3-[(E)-4-(dimethylamino)but-2-enoyl]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-9-carbonitrile |
|---|---|
| PubChem CID | 171095267 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (4aS)-8-amino-3-[(E)-4-(dimethylamino)but-2-enoyl]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-9-carbonitrile |
| SMILES | CN(C)C/C=C/C(=O)N1CCN2c3cc(C#N)c(N)cc3OC[C@@H]2C1 |
| InChI | InChI=1S/C18H23N5O2/c1-21(2)5-3-4-18(24)22-6-7-23-14(11-22)12-25-17-9-15(20)13(10-19)8-16(17)23/h3-4,8-9,14H,5-7,11-12,20H2,1-2H3/b4-3+/t14-/m0/s1 |
| InChIKey | FUCPHHIXONMXBU-XGACYXMMSA-N |
| XLogP | 0.67 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|