C27H28ClN7O2 — CID 142469036
(E)-1-[(7S)-11-chloro-12-(5-methyl-1H-indazol-4-yl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-5-yl]-4-(dimethylamino)but-2-en-1-one (PubChem CID 142469036) has the molecular formula C27H28ClN7O2 and a molecular weight of 518.02 g/mol. Its IUPAC name is (E)-1-[(7S)-11-chloro-12-(5-methyl-1H-indazol-4-yl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-5-yl]-4-(dimethylamino)but-2-en-1-one.
| Compound Name | (E)-1-[(7S)-11-chloro-12-(5-methyl-1H-indazol-4-yl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-5-yl]-4-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 142469036 |
| Molecular Formula | C27H28ClN7O2 |
| Molecular Weight | 518.02 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | (E)-1-[(7S)-11-chloro-12-(5-methyl-1H-indazol-4-yl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-5-yl]-4-(dimethylamino)but-2-en-1-one |
| SMILES | Cc1ccc2[nH]ncc2c1-c1cc2ncnc3c2c(c1Cl)OC[C@@H]1CN(C(=O)/C=C/CN(C)C)CCN31 |
| InChI | InChI=1S/C27H28ClN7O2/c1-16-6-7-20-19(12-31-32-20)23(16)18-11-21-24-26(25(18)28)37-14-17-13-34(22(36)5-4-8-33(2)3)9-10-35(17)27(24)30-15-29-21/h4-7,11-12,15,17H,8-10,13-14H2,1-3H3,(H,31,32)/b5-4+/t17-/m0/s1 |
| InChIKey | PVEPVRPEQYAMOT-BDUNBXCCSA-N |
| XLogP | 3.66 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.02 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|