C22H23ClN6O — CID 142469019
6-chloro-5-ethoxy-7-(5-methyl-1H-indazol-4-yl)-4-piperazin-1-ylquinazoline (PubChem CID 142469019) has the molecular formula C22H23ClN6O and a molecular weight of 422.92 g/mol. Its IUPAC name is 6-chloro-5-ethoxy-7-(5-methyl-1H-indazol-4-yl)-4-piperazin-1-ylquinazoline.
| Compound Name | 6-chloro-5-ethoxy-7-(5-methyl-1H-indazol-4-yl)-4-piperazin-1-ylquinazoline |
|---|---|
| PubChem CID | 142469019 |
| Molecular Formula | C22H23ClN6O |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 6-chloro-5-ethoxy-7-(5-methyl-1H-indazol-4-yl)-4-piperazin-1-ylquinazoline |
| SMILES | CCOc1c(Cl)c(-c2c(C)ccc3[nH]ncc23)cc2ncnc(N3CCNCC3)c12 |
| InChI | InChI=1S/C22H23ClN6O/c1-3-30-21-19-17(25-12-26-22(19)29-8-6-24-7-9-29)10-14(20(21)23)18-13(2)4-5-16-15(18)11-27-28-16/h4-5,10-12,24H,3,6-9H2,1-2H3,(H,27,28) |
| InChIKey | SEPXRDKYQGREIH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |