C28H23Cl2N7O — CID 176669795
1-[4-[6-chloro-7-(5-methyl-1H-indazol-4-yl)quinazolin-4-yl]piperazin-1-yl]-2-(4-chlorophenyl)-2-iminoethanone (PubChem CID 176669795) has the molecular formula C28H23Cl2N7O and a molecular weight of 544.45 g/mol. Its IUPAC name is 1-[4-[6-chloro-7-(5-methyl-1H-indazol-4-yl)quinazolin-4-yl]piperazin-1-yl]-2-(4-chlorophenyl)-2-iminoethanone.
| Compound Name | 1-[4-[6-chloro-7-(5-methyl-1H-indazol-4-yl)quinazolin-4-yl]piperazin-1-yl]-2-(4-chlorophenyl)-2-iminoethanone |
|---|---|
| PubChem CID | 176669795 |
| Molecular Formula | C28H23Cl2N7O |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 1-[4-[6-chloro-7-(5-methyl-1H-indazol-4-yl)quinazolin-4-yl]piperazin-1-yl]-2-(4-chlorophenyl)-2-iminoethanone |
| SMILES | [H]/N=C(/C(=O)N1CCN(c2ncnc3cc(-c4c(C)ccc5[nH]ncc45)c(Cl)cc23)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H23Cl2N7O/c1-16-2-7-23-21(14-34-35-23)25(16)19-13-24-20(12-22(19)30)27(33-15-32-24)36-8-10-37(11-9-36)28(38)26(31)17-3-5-18(29)6-4-17/h2-7,12-15,31H,8-11H2,1H3,(H,34,35)/b31-26+ |
| InChIKey | INMTUALDRZFYIF-GKPLWNPISA-N |
| XLogP | 5.50 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|