C27H29ClN6O2 — CID 146551323
6-chloro-7-(5-methyl-1H-indazol-4-yl)-2-(oxolan-3-yloxy)-4-(4-prop-2-enylpiperazin-1-yl)quinazoline (PubChem CID 146551323) has the molecular formula C27H29ClN6O2 and a molecular weight of 505.02 g/mol. Its IUPAC name is 6-chloro-7-(5-methyl-1H-indazol-4-yl)-2-(oxolan-3-yloxy)-4-(4-prop-2-enylpiperazin-1-yl)quinazoline.
| Compound Name | 6-chloro-7-(5-methyl-1H-indazol-4-yl)-2-(oxolan-3-yloxy)-4-(4-prop-2-enylpiperazin-1-yl)quinazoline |
|---|---|
| PubChem CID | 146551323 |
| Molecular Formula | C27H29ClN6O2 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 6-chloro-7-(5-methyl-1H-indazol-4-yl)-2-(oxolan-3-yloxy)-4-(4-prop-2-enylpiperazin-1-yl)quinazoline |
| SMILES | C=CCN1CCN(c2nc(OC3CCOC3)nc3cc(-c4c(C)ccc5[nH]ncc45)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C27H29ClN6O2/c1-3-7-33-8-10-34(11-9-33)26-20-13-22(28)19(25-17(2)4-5-23-21(25)15-29-32-23)14-24(20)30-27(31-26)36-18-6-12-35-16-18/h3-5,13-15,18H,1,6-12,16H2,2H3,(H,29,32) |
| InChIKey | HXDYWWMSHIMHDE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|