C25H32N4O3 — CID 71622760
4-(4-benzylpiperazin-1-yl)-5,6,7-triethoxyquinazoline (PubChem CID 71622760) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-5,6,7-triethoxyquinazoline.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-5,6,7-triethoxyquinazoline |
|---|---|
| PubChem CID | 71622760 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-5,6,7-triethoxyquinazoline |
| SMILES | CCOc1cc2ncnc(N3CCN(Cc4ccccc4)CC3)c2c(OCC)c1OCC |
| InChI | InChI=1S/C25H32N4O3/c1-4-30-21-16-20-22(24(32-6-3)23(21)31-5-2)25(27-18-26-20)29-14-12-28(13-15-29)17-19-10-8-7-9-11-19/h7-11,16,18H,4-6,12-15,17H2,1-3H3 |
| InChIKey | LZXNGSVYZLLPRS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |