About 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine
5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine (PubChem CID 19921687) has the molecular formula C16H24N6O2
and a molecular weight of 332.41 g/mol. Its IUPAC name is 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine.
Molecular Properties
| Compound Name | 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine |
| PubChem CID | 19921687 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine |
| SMILES | CCOc1cncnc1.CCOc1cncnc1N1CCNCC1 |
| InChI | InChI=1S/C10H16N4O.C6H8N2O/c1-2-15-9-7-12-8-13-10(9)14-5-3-11-4-6-14;1-2-9-6-3-7-5-8-4-6/h7-8,11H,2-6H2,1H3;3-5H,2H2,1H3 |
| InChIKey | CUEUPZLRQHWQNG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine?
The IUPAC name of 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine (CID 19921687) is 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine.
What is the SMILES notation for 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine?
The canonical SMILES for 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine is CCOc1cncnc1.CCOc1cncnc1N1CCNCC1.
What is the InChIKey of 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine?
The InChIKey is CUEUPZLRQHWQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O.C6H8N2O/c1-2-15-9-7-12-8-13-10(9)14-5-3-11-4-6-14;1-2-9-6-3-7-5-8-4-6/h7-8,11H,2-6H2,1H3;3-5H,2H2,1H3.
What are the key properties of 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine?
5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine has a molecular weight of 332.41 g/mol, XLogP of 1.16, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-4-piperazin-1-ylpyrimidine;5-ethoxypyrimidine is sourced from PubChem (CID 19921687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).