C12H18FN3O — CID 22053530
1-(5-ethoxy-6-fluoro-3-pyridinyl)-1,4-diazepane (PubChem CID 22053530) has the molecular formula C12H18FN3O and a molecular weight of 239.29 g/mol. Its IUPAC name is 1-(5-ethoxy-6-fluoro-3-pyridinyl)-1,4-diazepane.
| Compound Name | 1-(5-ethoxy-6-fluoro-3-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 22053530 |
| Molecular Formula | C12H18FN3O |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 1-(5-ethoxy-6-fluoro-3-pyridinyl)-1,4-diazepane |
| SMILES | CCOc1cc(N2CCCNCC2)cnc1F |
| InChI | InChI=1S/C12H18FN3O/c1-2-17-11-8-10(9-15-12(11)13)16-6-3-4-14-5-7-16/h8-9,14H,2-7H2,1H3 |
| InChIKey | PJOWZODKCBJYCA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|