C14H20ClN3 — CID 173179920
1-(5-but-2-enyl-6-chloro-3-pyridinyl)-1,4-diazepane (PubChem CID 173179920) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 1-(5-but-2-enyl-6-chloro-3-pyridinyl)-1,4-diazepane.
| Compound Name | 1-(5-but-2-enyl-6-chloro-3-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 173179920 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-(5-but-2-enyl-6-chloro-3-pyridinyl)-1,4-diazepane |
| SMILES | CC=CCc1cc(N2CCCNCC2)cnc1Cl |
| InChI | InChI=1S/C14H20ClN3/c1-2-3-5-12-10-13(11-17-14(12)15)18-8-4-6-16-7-9-18/h2-3,10-11,16H,4-9H2,1H3 |
| InChIKey | ZCCPAOUVXFNRGM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|