C12H18IN3 — CID 22053478
1-(5-ethyl-6-iodo-3-pyridinyl)-1,4-diazepane (PubChem CID 22053478) has the molecular formula C12H18IN3 and a molecular weight of 331.20 g/mol. Its IUPAC name is 1-(5-ethyl-6-iodo-3-pyridinyl)-1,4-diazepane.
| Compound Name | 1-(5-ethyl-6-iodo-3-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 22053478 |
| Molecular Formula | C12H18IN3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 1-(5-ethyl-6-iodo-3-pyridinyl)-1,4-diazepane |
| SMILES | CCc1cc(N2CCCNCC2)cnc1I |
| InChI | InChI=1S/C12H18IN3/c1-2-10-8-11(9-15-12(10)13)16-6-3-4-14-5-7-16/h8-9,14H,2-7H2,1H3 |
| InChIKey | DENLLEHAXFLXRV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|