C10H15N3O — CID 10559695
5-(1,4-diazepan-1-yl)pyridin-3-ol (PubChem CID 10559695) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)pyridin-3-ol.
| Compound Name | 5-(1,4-diazepan-1-yl)pyridin-3-ol |
|---|---|
| PubChem CID | 10559695 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)pyridin-3-ol |
| SMILES | Oc1cncc(N2CCCNCC2)c1 |
| InChI | InChI=1S/C10H15N3O/c14-10-6-9(7-12-8-10)13-4-1-2-11-3-5-13/h6-8,11,14H,1-5H2 |
| InChIKey | MJRZXRNJFQLHHY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |