C15H22N6O3 — CID 118038716
4-amino-2-[[1-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]amino]pyrimidine-5-carboxylic acid (PubChem CID 118038716) has the molecular formula C15H22N6O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-amino-2-[[1-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]amino]pyrimidine-5-carboxylic acid.
| Compound Name | 4-amino-2-[[1-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]amino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 118038716 |
| Molecular Formula | C15H22N6O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 4-amino-2-[[1-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]amino]pyrimidine-5-carboxylic acid |
| SMILES | CN(C)C/C=C/C(=O)N1CCC(Nc2ncc(C(=O)O)c(N)n2)C1 |
| InChI | InChI=1S/C15H22N6O3/c1-20(2)6-3-4-12(22)21-7-5-10(9-21)18-15-17-8-11(14(23)24)13(16)19-15/h3-4,8,10H,5-7,9H2,1-2H3,(H,23,24)(H3,16,17,18,19)/b4-3+ |
| InChIKey | FHCRXYDQYZFYOV-ONEGZZNKSA-N |
| XLogP | -0.11 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|