C16H29N5O — CID 169136098
(E)-4-(dimethylamino)-1-[3-[4-(methylamino)pyrazol-1-yl]pyrrolidin-1-yl]but-2-en-1-one;ethane (PubChem CID 169136098) has the molecular formula C16H29N5O and a molecular weight of 307.44 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[3-[4-(methylamino)pyrazol-1-yl]pyrrolidin-1-yl]but-2-en-1-one;ethane.
| Compound Name | (E)-4-(dimethylamino)-1-[3-[4-(methylamino)pyrazol-1-yl]pyrrolidin-1-yl]but-2-en-1-one;ethane |
|---|---|
| PubChem CID | 169136098 |
| Molecular Formula | C16H29N5O |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[3-[4-(methylamino)pyrazol-1-yl]pyrrolidin-1-yl]but-2-en-1-one;ethane |
| SMILES | CC.CNc1cnn(C2CCN(C(=O)/C=C/CN(C)C)C2)c1 |
| InChI | InChI=1S/C14H23N5O.C2H6/c1-15-12-9-16-19(10-12)13-6-8-18(11-13)14(20)5-4-7-17(2)3;1-2/h4-5,9-10,13,15H,6-8,11H2,1-3H3;1-2H3/b5-4+; |
| InChIKey | RYJZXSILBIEFRT-FXRZFVDSSA-N |
| XLogP | 1.84 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|