C23H44N4O2 — CID 176683830
4-acetylcyclohexane-1-carbaldehyde;ethane;N-methyl-1-(1-methylpiperidin-4-yl)pyrazol-4-amine (PubChem CID 176683830) has the molecular formula C23H44N4O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is 4-acetylcyclohexane-1-carbaldehyde;ethane;N-methyl-1-(1-methylpiperidin-4-yl)pyrazol-4-amine.
| Compound Name | 4-acetylcyclohexane-1-carbaldehyde;ethane;N-methyl-1-(1-methylpiperidin-4-yl)pyrazol-4-amine |
|---|---|
| PubChem CID | 176683830 |
| Molecular Formula | C23H44N4O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.35 |
| IUPAC Name | 4-acetylcyclohexane-1-carbaldehyde;ethane;N-methyl-1-(1-methylpiperidin-4-yl)pyrazol-4-amine |
| SMILES | CC.CC.CC(=O)C1CCC(C=O)CC1.CNc1cnn(C2CCN(C)CC2)c1 |
| InChI | InChI=1S/C10H18N4.C9H14O2.2C2H6/c1-11-9-7-12-14(8-9)10-3-5-13(2)6-4-10;1-7(11)9-4-2-8(6-10)3-5-9;2*1-2/h7-8,10-11H,3-6H2,1-2H3;6,8-9H,2-5H2,1H3;2*1-2H3 |
| InChIKey | BMFCRBDRKWQNLH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|