C13H17ClN6 — CID 172824528
5-chloro-N-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]pyrimidin-2-amine (PubChem CID 172824528) has the molecular formula C13H17ClN6 and a molecular weight of 292.77 g/mol. Its IUPAC name is 5-chloro-N-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 172824528 |
| Molecular Formula | C13H17ClN6 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 5-chloro-N-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]pyrimidin-2-amine |
| SMILES | CN1CCC(n2cc(Nc3ncc(Cl)cn3)cn2)CC1 |
| InChI | InChI=1S/C13H17ClN6/c1-19-4-2-12(3-5-19)20-9-11(8-17-20)18-13-15-6-10(14)7-16-13/h6-9,12H,2-5H2,1H3,(H,15,16,18) |
| InChIKey | URHMBJGGQPHDKG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |