C23H30N6O2 — CID 169158202
4-[2-[[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]amino]quinazolin-8-yl]oxycyclohexan-1-ol (PubChem CID 169158202) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-[2-[[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]amino]quinazolin-8-yl]oxycyclohexan-1-ol.
| Compound Name | 4-[2-[[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]amino]quinazolin-8-yl]oxycyclohexan-1-ol |
|---|---|
| PubChem CID | 169158202 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 4-[2-[[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]amino]quinazolin-8-yl]oxycyclohexan-1-ol |
| SMILES | CN1CCC(n2cc(Nc3ncc4cccc(OC5CCC(O)CC5)c4n3)cn2)CC1 |
| InChI | InChI=1S/C23H30N6O2/c1-28-11-9-18(10-12-28)29-15-17(14-25-29)26-23-24-13-16-3-2-4-21(22(16)27-23)31-20-7-5-19(30)6-8-20/h2-4,13-15,18-20,30H,5-12H2,1H3,(H,24,26,27) |
| InChIKey | BKJRWZPVYBXWLE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |