C17H19N5O2S2 — CID 169158221
4-[2-[(2-aminosulfanyl-1,3-thiazol-5-yl)amino]quinazolin-8-yl]oxycyclohexan-1-ol (PubChem CID 169158221) has the molecular formula C17H19N5O2S2 and a molecular weight of 389.51 g/mol. Its IUPAC name is 4-[2-[(2-aminosulfanyl-1,3-thiazol-5-yl)amino]quinazolin-8-yl]oxycyclohexan-1-ol.
| Compound Name | 4-[2-[(2-aminosulfanyl-1,3-thiazol-5-yl)amino]quinazolin-8-yl]oxycyclohexan-1-ol |
|---|---|
| PubChem CID | 169158221 |
| Molecular Formula | C17H19N5O2S2 |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 4-[2-[(2-aminosulfanyl-1,3-thiazol-5-yl)amino]quinazolin-8-yl]oxycyclohexan-1-ol |
| SMILES | NSc1ncc(Nc2ncc3cccc(OC4CCC(O)CC4)c3n2)s1 |
| InChI | InChI=1S/C17H19N5O2S2/c18-26-17-20-9-14(25-17)21-16-19-8-10-2-1-3-13(15(10)22-16)24-12-6-4-11(23)5-7-12/h1-3,8-9,11-12,23H,4-7,18H2,(H,19,21,22) |
| InChIKey | CGVGBIYNKWUUSJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|