C17H19N5O4S2 — CID 169158028
5-[[8-(4-hydroxycyclohexyl)oxyquinazolin-2-yl]amino]-1,3-thiazole-2-sulfonamide (PubChem CID 169158028) has the molecular formula C17H19N5O4S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 5-[[8-(4-hydroxycyclohexyl)oxyquinazolin-2-yl]amino]-1,3-thiazole-2-sulfonamide.
| Compound Name | 5-[[8-(4-hydroxycyclohexyl)oxyquinazolin-2-yl]amino]-1,3-thiazole-2-sulfonamide |
|---|---|
| PubChem CID | 169158028 |
| Molecular Formula | C17H19N5O4S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 5-[[8-(4-hydroxycyclohexyl)oxyquinazolin-2-yl]amino]-1,3-thiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ncc(Nc2ncc3cccc(OC4CCC(O)CC4)c3n2)s1 |
| InChI | InChI=1S/C17H19N5O4S2/c18-28(24,25)17-20-9-14(27-17)21-16-19-8-10-2-1-3-13(15(10)22-16)26-12-6-4-11(23)5-7-12/h1-3,8-9,11-12,23H,4-7H2,(H2,18,24,25)(H,19,21,22) |
| InChIKey | QWQAOIXAZYBNLK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |