C20H29N7OS2 — CID 169158053
ethane;2-hydrazinylsulfanyl-N-[8-[4-(methylamino)cyclohexyl]oxyquinazolin-2-yl]-1,3-thiazol-5-amine (PubChem CID 169158053) has the molecular formula C20H29N7OS2 and a molecular weight of 447.63 g/mol. Its IUPAC name is ethane;2-hydrazinylsulfanyl-N-[8-[4-(methylamino)cyclohexyl]oxyquinazolin-2-yl]-1,3-thiazol-5-amine.
| Compound Name | ethane;2-hydrazinylsulfanyl-N-[8-[4-(methylamino)cyclohexyl]oxyquinazolin-2-yl]-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 169158053 |
| Molecular Formula | C20H29N7OS2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | ethane;2-hydrazinylsulfanyl-N-[8-[4-(methylamino)cyclohexyl]oxyquinazolin-2-yl]-1,3-thiazol-5-amine |
| SMILES | CC.CNC1CCC(Oc2cccc3cnc(Nc4cnc(SNN)s4)nc23)CC1 |
| InChI | InChI=1S/C18H23N7OS2.C2H6/c1-20-12-5-7-13(8-6-12)26-14-4-2-3-11-9-21-17(24-16(11)14)23-15-10-22-18(27-15)28-25-19;1-2/h2-4,9-10,12-13,20,25H,5-8,19H2,1H3,(H,21,23,24);1-2H3 |
| InChIKey | QTYSFLSAJLOUIY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|