C18H21N5O4S2 — CID 169158231
5-[[8-(4-methoxycyclohexyl)oxyquinazolin-2-yl]amino]-1,3-thiazole-2-sulfonamide (PubChem CID 169158231) has the molecular formula C18H21N5O4S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 5-[[8-(4-methoxycyclohexyl)oxyquinazolin-2-yl]amino]-1,3-thiazole-2-sulfonamide.
| Compound Name | 5-[[8-(4-methoxycyclohexyl)oxyquinazolin-2-yl]amino]-1,3-thiazole-2-sulfonamide |
|---|---|
| PubChem CID | 169158231 |
| Molecular Formula | C18H21N5O4S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 5-[[8-(4-methoxycyclohexyl)oxyquinazolin-2-yl]amino]-1,3-thiazole-2-sulfonamide |
| SMILES | COC1CCC(Oc2cccc3cnc(Nc4cnc(S(N)(=O)=O)s4)nc23)CC1 |
| InChI | InChI=1S/C18H21N5O4S2/c1-26-12-5-7-13(8-6-12)27-14-4-2-3-11-9-20-17(23-16(11)14)22-15-10-21-18(28-15)29(19,24)25/h2-4,9-10,12-13H,5-8H2,1H3,(H2,19,24,25)(H,20,22,23) |
| InChIKey | KAMUTKMVOOPLCY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |