C12H22N6 — CID 154930834
1,2-dimethyl-3-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]guanidine (PubChem CID 154930834) has the molecular formula C12H22N6 and a molecular weight of 250.35 g/mol. Its IUPAC name is 1,2-dimethyl-3-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]guanidine.
| Compound Name | 1,2-dimethyl-3-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]guanidine |
|---|---|
| PubChem CID | 154930834 |
| Molecular Formula | C12H22N6 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1,2-dimethyl-3-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]guanidine |
| SMILES | C/N=C(\NC)Nc1cnn(C2CCN(C)CC2)c1 |
| InChI | InChI=1S/C12H22N6/c1-13-12(14-2)16-10-8-15-18(9-10)11-4-6-17(3)7-5-11/h8-9,11H,4-7H2,1-3H3,(H2,13,14,16) |
| InChIKey | YPUZGNRWSLPDII-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|