C7H13N5 — CID 130971071
1,2-dimethyl-3-(1-methylpyrazol-4-yl)guanidine (PubChem CID 130971071) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is 1,2-dimethyl-3-(1-methylpyrazol-4-yl)guanidine.
| Compound Name | 1,2-dimethyl-3-(1-methylpyrazol-4-yl)guanidine |
|---|---|
| PubChem CID | 130971071 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 1,2-dimethyl-3-(1-methylpyrazol-4-yl)guanidine |
| SMILES | C/N=C(\NC)Nc1cnn(C)c1 |
| InChI | InChI=1S/C7H13N5/c1-8-7(9-2)11-6-4-10-12(3)5-6/h4-5H,1-3H3,(H2,8,9,11) |
| InChIKey | POHPFNUQWYXMEX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|