C17H22BrN3O5 — CID 170995570
tert-butyl 4-(2-bromo-4-nitrobenzoyl)-3-methylpiperazine-1-carboxylate (PubChem CID 170995570) has the molecular formula C17H22BrN3O5 and a molecular weight of 428.28 g/mol. Its IUPAC name is tert-butyl 4-(2-bromo-4-nitrobenzoyl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-bromo-4-nitrobenzoyl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 170995570 |
| Molecular Formula | C17H22BrN3O5 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | tert-butyl 4-(2-bromo-4-nitrobenzoyl)-3-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1C(=O)c1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C17H22BrN3O5/c1-11-10-19(16(23)26-17(2,3)4)7-8-20(11)15(22)13-6-5-12(21(24)25)9-14(13)18/h5-6,9,11H,7-8,10H2,1-4H3 |
| InChIKey | RWLVMTUQVBYJKG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|