C18H25FN2O4 — CID 171906086
tert-butyl 4-(2-fluoro-5-hydroxy-4-methylbenzoyl)-3-methylpiperazine-1-carboxylate (PubChem CID 171906086) has the molecular formula C18H25FN2O4 and a molecular weight of 352.41 g/mol. Its IUPAC name is tert-butyl 4-(2-fluoro-5-hydroxy-4-methylbenzoyl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-fluoro-5-hydroxy-4-methylbenzoyl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 171906086 |
| Molecular Formula | C18H25FN2O4 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | tert-butyl 4-(2-fluoro-5-hydroxy-4-methylbenzoyl)-3-methylpiperazine-1-carboxylate |
| SMILES | Cc1cc(F)c(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2C)cc1O |
| InChI | InChI=1S/C18H25FN2O4/c1-11-8-14(19)13(9-15(11)22)16(23)21-7-6-20(10-12(21)2)17(24)25-18(3,4)5/h8-9,12,22H,6-7,10H2,1-5H3 |
| InChIKey | SMGVFHBAXGAIGI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |