C20H27FN2O3 — CID 171037729
tert-butyl (3S)-4-(4-ethenyl-2-fluoro-6-methylbenzoyl)-3-methylpiperazine-1-carboxylate (PubChem CID 171037729) has the molecular formula C20H27FN2O3 and a molecular weight of 362.45 g/mol. Its IUPAC name is tert-butyl (3S)-4-(4-ethenyl-2-fluoro-6-methylbenzoyl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-(4-ethenyl-2-fluoro-6-methylbenzoyl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 171037729 |
| Molecular Formula | C20H27FN2O3 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | tert-butyl (3S)-4-(4-ethenyl-2-fluoro-6-methylbenzoyl)-3-methylpiperazine-1-carboxylate |
| SMILES | C=Cc1cc(C)c(C(=O)N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C)c(F)c1 |
| InChI | InChI=1S/C20H27FN2O3/c1-7-15-10-13(2)17(16(21)11-15)18(24)23-9-8-22(12-14(23)3)19(25)26-20(4,5)6/h7,10-11,14H,1,8-9,12H2,2-6H3/t14-/m0/s1 |
| InChIKey | BOZUATGIYMUFCA-AWEZNQCLSA-N |
| XLogP | 3.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |