C17H23BrClN3O3 — CID 155684338
tert-butyl (4aR)-10-amino-8-bromo-7-chloro-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylate (PubChem CID 155684338) has the molecular formula C17H23BrClN3O3 and a molecular weight of 432.75 g/mol. Its IUPAC name is tert-butyl (4aR)-10-amino-8-bromo-7-chloro-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylate.
| Compound Name | tert-butyl (4aR)-10-amino-8-bromo-7-chloro-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylate |
|---|---|
| PubChem CID | 155684338 |
| Molecular Formula | C17H23BrClN3O3 |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | tert-butyl (4aR)-10-amino-8-bromo-7-chloro-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2Cc3c(N)cc(Br)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C17H23BrClN3O3/c1-17(2,3)25-16(23)22-5-4-21-8-11-13(20)6-12(18)14(19)15(11)24-9-10(21)7-22/h6,10H,4-5,7-9,20H2,1-3H3/t10-/m1/s1 |
| InChIKey | NHTFZWUWIHIYRS-SNVBAGLBSA-N |
| XLogP | 3.50 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|