C23H33BrN2O3Si — CID 155684283
tert-butyl (4aR)-8-bromo-7-methyl-9-(2-trimethylsilylethynyl)-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylate (PubChem CID 155684283) has the molecular formula C23H33BrN2O3Si and a molecular weight of 493.52 g/mol. Its IUPAC name is tert-butyl (4aR)-8-bromo-7-methyl-9-(2-trimethylsilylethynyl)-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylate.
| Compound Name | tert-butyl (4aR)-8-bromo-7-methyl-9-(2-trimethylsilylethynyl)-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylate |
|---|---|
| PubChem CID | 155684283 |
| Molecular Formula | C23H33BrN2O3Si |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | tert-butyl (4aR)-8-bromo-7-methyl-9-(2-trimethylsilylethynyl)-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylate |
| SMILES | Cc1c(Br)c(C#C[Si](C)(C)C)cc2c1OC[C@H]1CN(C(=O)OC(C)(C)C)CCN1C2 |
| InChI | InChI=1S/C23H33BrN2O3Si/c1-16-20(24)17(8-11-30(5,6)7)12-18-13-25-9-10-26(22(27)29-23(2,3)4)14-19(25)15-28-21(16)18/h12,19H,9-10,13-15H2,1-7H3/t19-/m1/s1 |
| InChIKey | KVDUUJQMMQHEKQ-LJQANCHMSA-N |
| XLogP | 4.80 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|