C19H29Cl2N3O3 — CID 155684317
tert-butyl 4,7-dichloro-6-methyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate;ethane (PubChem CID 155684317) has the molecular formula C19H29Cl2N3O3 and a molecular weight of 418.37 g/mol. Its IUPAC name is tert-butyl 4,7-dichloro-6-methyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate;ethane.
| Compound Name | tert-butyl 4,7-dichloro-6-methyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate;ethane |
|---|---|
| PubChem CID | 155684317 |
| Molecular Formula | C19H29Cl2N3O3 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | tert-butyl 4,7-dichloro-6-methyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate;ethane |
| SMILES | CC.Cc1nc(Cl)c2c(c1Cl)OCC1CN(C(=O)OC(C)(C)C)CCN1C2 |
| InChI | InChI=1S/C17H23Cl2N3O3.C2H6/c1-10-13(18)14-12(15(19)20-10)8-21-5-6-22(7-11(21)9-24-14)16(23)25-17(2,3)4;1-2/h11H,5-9H2,1-4H3;1-2H3 |
| InChIKey | BGMLVXUNTXCRSS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|