C22H29Cl2N5O4 — CID 166870526
tert-butyl (11R)-6,7-dichloro-4-[[(1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]amino]-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate (PubChem CID 166870526) has the molecular formula C22H29Cl2N5O4 and a molecular weight of 498.41 g/mol. Its IUPAC name is tert-butyl (11R)-6,7-dichloro-4-[[(1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]amino]-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate.
| Compound Name | tert-butyl (11R)-6,7-dichloro-4-[[(1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]amino]-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate |
|---|---|
| PubChem CID | 166870526 |
| Molecular Formula | C22H29Cl2N5O4 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | tert-butyl (11R)-6,7-dichloro-4-[[(1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]amino]-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate |
| SMILES | CN1C[C@@H]2C(Nc3nc(Cl)c(Cl)c4c3C(=O)N3CCN(C(=O)OC(C)(C)C)C[C@@H]3CO4)[C@@H]2C1 |
| InChI | InChI=1S/C22H29Cl2N5O4/c1-22(2,3)33-21(31)28-5-6-29-11(7-28)10-32-17-14(20(29)30)19(26-18(24)15(17)23)25-16-12-8-27(4)9-13(12)16/h11-13,16H,5-10H2,1-4H3,(H,25,26)/t11-,12-,13+,16?/m1/s1 |
| InChIKey | AKZXWPGDTARKGE-ABUXHAGHSA-N |
| XLogP | 2.81 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|