C25H35Cl2F2N5O4 — CID 166870816
tert-butyl (11R)-6,7-dichloro-4-[4-[2,2-difluoroethyl(methyl)amino]-2,2-dimethylpyrrolidin-1-yl]-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate (PubChem CID 166870816) has the molecular formula C25H35Cl2F2N5O4 and a molecular weight of 578.49 g/mol. Its IUPAC name is tert-butyl (11R)-6,7-dichloro-4-[4-[2,2-difluoroethyl(methyl)amino]-2,2-dimethylpyrrolidin-1-yl]-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate.
| Compound Name | tert-butyl (11R)-6,7-dichloro-4-[4-[2,2-difluoroethyl(methyl)amino]-2,2-dimethylpyrrolidin-1-yl]-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate |
|---|---|
| PubChem CID | 166870816 |
| Molecular Formula | C25H35Cl2F2N5O4 |
| Molecular Weight | 578.49 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | tert-butyl (11R)-6,7-dichloro-4-[4-[2,2-difluoroethyl(methyl)amino]-2,2-dimethylpyrrolidin-1-yl]-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate |
| SMILES | CN(CC(F)F)C1CN(c2nc(Cl)c(Cl)c3c2C(=O)N2CCN(C(=O)OC(C)(C)C)C[C@@H]2CO3)C(C)(C)C1 |
| InChI | InChI=1S/C25H35Cl2F2N5O4/c1-24(2,3)38-23(36)32-7-8-33-15(10-32)13-37-19-17(22(33)35)21(30-20(27)18(19)26)34-11-14(9-25(34,4)5)31(6)12-16(28)29/h14-16H,7-13H2,1-6H3/t14?,15-/m1/s1 |
| InChIKey | ONIDDOFGSWGZCC-YSSOQSIOSA-N |
| XLogP | 4.40 |
| TPSA | 78.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|