C22H30ClFN4O5 — CID 166869508
tert-butyl (11R)-6-chloro-7-fluoro-4-[(4S)-4-hydroxy-2,2-dimethylpyrrolidin-1-yl]-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate (PubChem CID 166869508) has the molecular formula C22H30ClFN4O5 and a molecular weight of 484.96 g/mol. Its IUPAC name is tert-butyl (11R)-6-chloro-7-fluoro-4-[(4S)-4-hydroxy-2,2-dimethylpyrrolidin-1-yl]-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate.
| Compound Name | tert-butyl (11R)-6-chloro-7-fluoro-4-[(4S)-4-hydroxy-2,2-dimethylpyrrolidin-1-yl]-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate |
|---|---|
| PubChem CID | 166869508 |
| Molecular Formula | C22H30ClFN4O5 |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | tert-butyl (11R)-6-chloro-7-fluoro-4-[(4S)-4-hydroxy-2,2-dimethylpyrrolidin-1-yl]-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=O)c3c(N4C[C@@H](O)CC4(C)C)nc(Cl)c(F)c3OC[C@H]2C1 |
| InChI | InChI=1S/C22H30ClFN4O5/c1-21(2,3)33-20(31)26-6-7-27-12(9-26)11-32-16-14(19(27)30)18(25-17(23)15(16)24)28-10-13(29)8-22(28,4)5/h12-13,29H,6-11H2,1-5H3/t12-,13+/m1/s1 |
| InChIKey | JJWWTKRUEYRCBD-OLZOCXBDSA-N |
| XLogP | 2.68 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|