C25H27F2N5O4 — CID 168820520
(11R)-7-fluoro-6-(3-fluoro-2-pyridinyl)-4-(4-hydroxy-2,2-dimethylpyrrolidin-1-yl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 168820520) has the molecular formula C25H27F2N5O4 and a molecular weight of 499.52 g/mol. Its IUPAC name is (11R)-7-fluoro-6-(3-fluoro-2-pyridinyl)-4-(4-hydroxy-2,2-dimethylpyrrolidin-1-yl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-7-fluoro-6-(3-fluoro-2-pyridinyl)-4-(4-hydroxy-2,2-dimethylpyrrolidin-1-yl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 168820520 |
| Molecular Formula | C25H27F2N5O4 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | (11R)-7-fluoro-6-(3-fluoro-2-pyridinyl)-4-(4-hydroxy-2,2-dimethylpyrrolidin-1-yl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | C=CC(=O)N1CCN2C(=O)c3c(N4CC(O)CC4(C)C)nc(-c4ncccc4F)c(F)c3OC[C@H]2C1 |
| InChI | InChI=1S/C25H27F2N5O4/c1-4-17(34)30-8-9-31-14(11-30)13-36-22-18(24(31)35)23(32-12-15(33)10-25(32,2)3)29-21(19(22)27)20-16(26)6-5-7-28-20/h4-7,14-15,33H,1,8-13H2,2-3H3/t14-,15?/m1/s1 |
| InChIKey | OSOKUKLNDWOPMA-GICMACPYSA-N |
| XLogP | 2.00 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|