C27H30F2N4O5 — CID 166870157
(11R,15S)-7-fluoro-6-(2-fluoro-6-hydroxyphenyl)-4-[(4S)-4-hydroxy-2,2-dimethylpyrrolidin-1-yl]-15-methyl-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 166870157) has the molecular formula C27H30F2N4O5 and a molecular weight of 528.56 g/mol. Its IUPAC name is (11R,15S)-7-fluoro-6-(2-fluoro-6-hydroxyphenyl)-4-[(4S)-4-hydroxy-2,2-dimethylpyrrolidin-1-yl]-15-methyl-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R,15S)-7-fluoro-6-(2-fluoro-6-hydroxyphenyl)-4-[(4S)-4-hydroxy-2,2-dimethylpyrrolidin-1-yl]-15-methyl-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 166870157 |
| Molecular Formula | C27H30F2N4O5 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | (11R,15S)-7-fluoro-6-(2-fluoro-6-hydroxyphenyl)-4-[(4S)-4-hydroxy-2,2-dimethylpyrrolidin-1-yl]-15-methyl-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | C=CC(=O)N1C[C@@H]2COc3c(F)c(-c4c(O)cccc4F)nc(N4C[C@@H](O)CC4(C)C)c3C(=O)N2[C@@H](C)C1 |
| InChI | InChI=1S/C27H30F2N4O5/c1-5-19(36)31-10-14(2)33-15(11-31)13-38-24-21(26(33)37)25(32-12-16(34)9-27(32,3)4)30-23(22(24)29)20-17(28)7-6-8-18(20)35/h5-8,14-16,34-35H,1,9-13H2,2-4H3/t14-,15+,16-/m0/s1 |
| InChIKey | GZDIPWILEHIVPX-XHSDSOJGSA-N |
| XLogP | 2.70 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|