C28H24ClFN4O4 — CID 166870706
(11R)-7-chloro-4-(2,3-dihydroindol-1-yl)-6-(2-fluoro-6-hydroxyphenyl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 166870706) has the molecular formula C28H24ClFN4O4 and a molecular weight of 534.98 g/mol. Its IUPAC name is (11R)-7-chloro-4-(2,3-dihydroindol-1-yl)-6-(2-fluoro-6-hydroxyphenyl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-7-chloro-4-(2,3-dihydroindol-1-yl)-6-(2-fluoro-6-hydroxyphenyl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 166870706 |
| Molecular Formula | C28H24ClFN4O4 |
| Molecular Weight | 534.98 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | (11R)-7-chloro-4-(2,3-dihydroindol-1-yl)-6-(2-fluoro-6-hydroxyphenyl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | C=CC(=O)N1CCN2C(=O)c3c(N4CCc5ccccc54)nc(-c4c(O)cccc4F)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C28H24ClFN4O4/c1-2-21(36)32-12-13-33-17(14-32)15-38-26-23(28(33)37)27(34-11-10-16-6-3-4-8-19(16)34)31-25(24(26)29)22-18(30)7-5-9-20(22)35/h2-9,17,35H,1,10-15H2/t17-/m1/s1 |
| InChIKey | RFKXRGSNDUJQGI-QGZVFWFLSA-N |
| XLogP | 4.17 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.98 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|