C26H29Cl2N5O4 — CID 166869934
(11R)-7-chloro-6-(2-chloro-6-hydroxyphenyl)-4-[(2S)-2,4-dimethylpiperazin-1-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 166869934) has the molecular formula C26H29Cl2N5O4 and a molecular weight of 546.46 g/mol. Its IUPAC name is (11R)-7-chloro-6-(2-chloro-6-hydroxyphenyl)-4-[(2S)-2,4-dimethylpiperazin-1-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-7-chloro-6-(2-chloro-6-hydroxyphenyl)-4-[(2S)-2,4-dimethylpiperazin-1-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 166869934 |
| Molecular Formula | C26H29Cl2N5O4 |
| Molecular Weight | 546.46 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | (11R)-7-chloro-6-(2-chloro-6-hydroxyphenyl)-4-[(2S)-2,4-dimethylpiperazin-1-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | C=CC(=O)N1CCN2C(=O)c3c(N4CCN(C)C[C@@H]4C)nc(-c4c(O)cccc4Cl)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C26H29Cl2N5O4/c1-4-19(35)31-9-11-33-16(13-31)14-37-24-21(26(33)36)25(32-10-8-30(3)12-15(32)2)29-23(22(24)28)20-17(27)6-5-7-18(20)34/h4-7,15-16,34H,1,8-14H2,2-3H3/t15-,16+/m0/s1 |
| InChIKey | ANOBNODZSUTNAJ-JKSUJKDBSA-N |
| XLogP | 3.13 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|