C27H31ClFN5O3 — CID 166870165
(11R)-7-chloro-6-(2-fluorophenyl)-13-prop-2-enoyl-4-[(2S,3R)-2,3,4-trimethylpiperazin-1-yl]-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 166870165) has the molecular formula C27H31ClFN5O3 and a molecular weight of 528.03 g/mol. Its IUPAC name is (11R)-7-chloro-6-(2-fluorophenyl)-13-prop-2-enoyl-4-[(2S,3R)-2,3,4-trimethylpiperazin-1-yl]-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-7-chloro-6-(2-fluorophenyl)-13-prop-2-enoyl-4-[(2S,3R)-2,3,4-trimethylpiperazin-1-yl]-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 166870165 |
| Molecular Formula | C27H31ClFN5O3 |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | (11R)-7-chloro-6-(2-fluorophenyl)-13-prop-2-enoyl-4-[(2S,3R)-2,3,4-trimethylpiperazin-1-yl]-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | C=CC(=O)N1CCN2C(=O)c3c(N4CCN(C)[C@H](C)[C@@H]4C)nc(-c4ccccc4F)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C27H31ClFN5O3/c1-5-21(35)32-11-13-34-18(14-32)15-37-25-22(27(34)36)26(33-12-10-31(4)16(2)17(33)3)30-24(23(25)28)19-8-6-7-9-20(19)29/h5-9,16-18H,1,10-15H2,2-4H3/t16-,17+,18-/m1/s1 |
| InChIKey | JUPIFXQABUDWRH-FGTMMUONSA-N |
| XLogP | 3.30 |
| TPSA | 69.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|