C25H26ClFN4O5 — CID 166869585
(11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-4-[(2R)-2-methylmorpholin-4-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 166869585) has the molecular formula C25H26ClFN4O5 and a molecular weight of 516.96 g/mol. Its IUPAC name is (11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-4-[(2R)-2-methylmorpholin-4-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-4-[(2R)-2-methylmorpholin-4-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 166869585 |
| Molecular Formula | C25H26ClFN4O5 |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | (11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-4-[(2R)-2-methylmorpholin-4-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | C=CC(=O)N1CCN2C(=O)c3c(N4CCO[C@H](C)C4)nc(-c4c(O)cccc4F)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C25H26ClFN4O5/c1-3-18(33)29-7-8-31-15(12-29)13-36-23-20(25(31)34)24(30-9-10-35-14(2)11-30)28-22(21(23)26)19-16(27)5-4-6-17(19)32/h3-6,14-15,32H,1,7-13H2,2H3/t14-,15-/m1/s1 |
| InChIKey | LZXJTVKXEWIZRS-HUUCEWRRSA-N |
| XLogP | 2.70 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|