C27H28ClF4N5O4 — CID 166870218
(11R)-7-chloro-4-[(2S,3R)-2,3-dimethyl-4-(trifluoromethyl)piperazin-1-yl]-6-(2-fluoro-6-hydroxyphenyl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 166870218) has the molecular formula C27H28ClF4N5O4 and a molecular weight of 598.00 g/mol. Its IUPAC name is (11R)-7-chloro-4-[(2S,3R)-2,3-dimethyl-4-(trifluoromethyl)piperazin-1-yl]-6-(2-fluoro-6-hydroxyphenyl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-7-chloro-4-[(2S,3R)-2,3-dimethyl-4-(trifluoromethyl)piperazin-1-yl]-6-(2-fluoro-6-hydroxyphenyl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 166870218 |
| Molecular Formula | C27H28ClF4N5O4 |
| Molecular Weight | 598.00 g/mol |
| Exact Mass | 597.18 |
| IUPAC Name | (11R)-7-chloro-4-[(2S,3R)-2,3-dimethyl-4-(trifluoromethyl)piperazin-1-yl]-6-(2-fluoro-6-hydroxyphenyl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | C=CC(=O)N1CCN2C(=O)c3c(N4CCN(C(F)(F)F)[C@H](C)[C@@H]4C)nc(-c4c(O)cccc4F)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C27H28ClF4N5O4/c1-4-19(39)34-8-9-36-16(12-34)13-41-24-21(26(36)40)25(35-10-11-37(27(30,31)32)15(3)14(35)2)33-23(22(24)28)20-17(29)6-5-7-18(20)38/h4-7,14-16,38H,1,8-13H2,2-3H3/t14-,15+,16+/m0/s1 |
| InChIKey | CDVZBXGFPYODPV-ARFHVFGLSA-N |
| XLogP | 3.90 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.00 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|