C26H29F2N5O4 — CID 166869676
(11R)-4-(3-amino-2,2-dimethylpyrrolidin-1-yl)-7-fluoro-6-(2-fluoro-6-hydroxyphenyl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 166869676) has the molecular formula C26H29F2N5O4 and a molecular weight of 513.55 g/mol. Its IUPAC name is (11R)-4-(3-amino-2,2-dimethylpyrrolidin-1-yl)-7-fluoro-6-(2-fluoro-6-hydroxyphenyl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-4-(3-amino-2,2-dimethylpyrrolidin-1-yl)-7-fluoro-6-(2-fluoro-6-hydroxyphenyl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 166869676 |
| Molecular Formula | C26H29F2N5O4 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | (11R)-4-(3-amino-2,2-dimethylpyrrolidin-1-yl)-7-fluoro-6-(2-fluoro-6-hydroxyphenyl)-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | C=CC(=O)N1CCN2C(=O)c3c(N4CCC(N)C4(C)C)nc(-c4c(O)cccc4F)c(F)c3OC[C@H]2C1 |
| InChI | InChI=1S/C26H29F2N5O4/c1-4-18(35)31-10-11-32-14(12-31)13-37-23-20(25(32)36)24(33-9-8-17(29)26(33,2)3)30-22(21(23)28)19-15(27)6-5-7-16(19)34/h4-7,14,17,34H,1,8-13,29H2,2-3H3/t14-,17?/m1/s1 |
| InChIKey | JIRWPRAJCZERLG-XPCCGILXSA-N |
| XLogP | 2.28 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|