C27H30Cl2FN5O3 — CID 166870433
(11R)-7-chloro-6-(2-chloro-6-fluorophenyl)-4-[2,2-dimethyl-4-(methylamino)pyrrolidin-1-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 166870433) has the molecular formula C27H30Cl2FN5O3 and a molecular weight of 562.47 g/mol. Its IUPAC name is (11R)-7-chloro-6-(2-chloro-6-fluorophenyl)-4-[2,2-dimethyl-4-(methylamino)pyrrolidin-1-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-7-chloro-6-(2-chloro-6-fluorophenyl)-4-[2,2-dimethyl-4-(methylamino)pyrrolidin-1-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 166870433 |
| Molecular Formula | C27H30Cl2FN5O3 |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | (11R)-7-chloro-6-(2-chloro-6-fluorophenyl)-4-[2,2-dimethyl-4-(methylamino)pyrrolidin-1-yl]-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | C=CC(=O)N1CCN2C(=O)c3c(N4CC(NC)CC4(C)C)nc(-c4c(F)cccc4Cl)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C27H30Cl2FN5O3/c1-5-19(36)33-9-10-34-16(13-33)14-38-24-21(26(34)37)25(35-12-15(31-4)11-27(35,2)3)32-23(22(24)29)20-17(28)7-6-8-18(20)30/h5-8,15-16,31H,1,9-14H2,2-4H3/t15?,16-/m1/s1 |
| InChIKey | WSIYUOMVPAUTTD-OEMAIJDKSA-N |
| XLogP | 4.00 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|