C22H30N2O5 — CID 144537834
tert-butyl 3-(4-ethyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate (PubChem CID 144537834) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is tert-butyl 3-(4-ethyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate.
| Compound Name | tert-butyl 3-(4-ethyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate |
|---|---|
| PubChem CID | 144537834 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | tert-butyl 3-(4-ethyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate |
| SMILES | CCc1c(C2CN3CCN(C(=O)OC(C)(C)C)CC3CO2)ccc2c1COC2=O |
| InChI | InChI=1S/C22H30N2O5/c1-5-15-16(6-7-17-18(15)13-28-20(17)25)19-11-23-8-9-24(10-14(23)12-27-19)21(26)29-22(2,3)4/h6-7,14,19H,5,8-13H2,1-4H3 |
| InChIKey | HAHMBLBKKLRGEI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |