C21H28N2O4S — CID 130439284
tert-butyl (9aS)-3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]thiazine-8-carboxylate (PubChem CID 130439284) has the molecular formula C21H28N2O4S and a molecular weight of 404.50 g/mol. Its IUPAC name is tert-butyl (9aS)-3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]thiazine-8-carboxylate.
| Compound Name | tert-butyl (9aS)-3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]thiazine-8-carboxylate |
|---|---|
| PubChem CID | 130439284 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | tert-butyl (9aS)-3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]thiazine-8-carboxylate |
| SMILES | CC1=C(C=CC2=C1COC2=O)C3CN4CCN(C[C@H]4CS3)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H28N2O4S/c1-13-15(5-6-16-17(13)11-26-19(16)24)18-10-22-7-8-23(9-14(22)12-28-18)20(25)27-21(2,3)4/h5-6,14,18H,7-12H2,1-4H3/t14-,18?/m0/s1 |
| InChIKey | VHCUHIGKEGFMNS-PIVQAISJSA-N |
| XLogP | 2.70 |
| TPSA | 84.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | 622 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |