C29H35N3O6 — CID 90344988
8-O-benzyl 2-O-tert-butyl (3R,9aS)-3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2,8-dicarboxylate (PubChem CID 90344988) has the molecular formula C29H35N3O6 and a molecular weight of 521.61 g/mol. Its IUPAC name is 8-O-benzyl 2-O-tert-butyl (3R,9aS)-3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2,8-dicarboxylate.
| Compound Name | 8-O-benzyl 2-O-tert-butyl (3R,9aS)-3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2,8-dicarboxylate |
|---|---|
| PubChem CID | 90344988 |
| Molecular Formula | C29H35N3O6 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 8-O-benzyl 2-O-tert-butyl (3R,9aS)-3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2,8-dicarboxylate |
| SMILES | Cc1c([C@@H]2CN3CCN(C(=O)OCc4ccccc4)C[C@H]3CN2C(=O)OC(C)(C)C)ccc2c1COC2=O |
| InChI | InChI=1S/C29H35N3O6/c1-19-22(10-11-23-24(19)18-36-26(23)33)25-16-30-12-13-31(27(34)37-17-20-8-6-5-7-9-20)14-21(30)15-32(25)28(35)38-29(2,3)4/h5-11,21,25H,12-18H2,1-4H3/t21-,25-/m0/s1 |
| InChIKey | VDMGBMLZVKSPBZ-OFVILXPXSA-N |
| XLogP | 4.28 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|